C11H14O4 — CID 153408459
prop-2-enoyl 4,4-dimethylcyclopentene-1-carboperoxoate (PubChem CID 153408459) has the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. Its IUPAC name is prop-2-enoyl 4,4-dimethylcyclopentene-1-carboperoxoate.
| Compound Name | prop-2-enoyl 4,4-dimethylcyclopentene-1-carboperoxoate |
|---|---|
| PubChem CID | 153408459 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | prop-2-enoyl 4,4-dimethylcyclopentene-1-carboperoxoate |
| SMILES | C=CC(=O)OOC(=O)C1=CCC(C)(C)C1 |
| InChI | InChI=1S/C11H14O4/c1-4-9(12)14-15-10(13)8-5-6-11(2,3)7-8/h4-5H,1,6-7H2,2-3H3 |
| InChIKey | OQKZGLDTTKFISX-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|