C8H8O6 — CID 176729362
prop-2-enoyl 3-hydroxy-2,3-dihydrofuran-4-carboperoxoate (PubChem CID 176729362) has the molecular formula C8H8O6 and a molecular weight of 200.15 g/mol. Its IUPAC name is prop-2-enoyl 3-hydroxy-2,3-dihydrofuran-4-carboperoxoate.
| Compound Name | prop-2-enoyl 3-hydroxy-2,3-dihydrofuran-4-carboperoxoate |
|---|---|
| PubChem CID | 176729362 |
| Molecular Formula | C8H8O6 |
| Molecular Weight | 200.15 g/mol |
| Exact Mass | 200.03 |
| IUPAC Name | prop-2-enoyl 3-hydroxy-2,3-dihydrofuran-4-carboperoxoate |
| SMILES | C=CC(=O)OOC(=O)C1=COCC1O |
| InChI | InChI=1S/C8H8O6/c1-2-7(10)13-14-8(11)5-3-12-4-6(5)9/h2-3,6,9H,1,4H2 |
| InChIKey | WGVJBUDOTOKUMH-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.15 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|