About oxirane;prop-2-enoyloxy prop-2-eneperoxoate
oxirane;prop-2-enoyloxy prop-2-eneperoxoate (PubChem CID 88522939) has the molecular formula C8H10O6
and a molecular weight of 202.16 g/mol. Its IUPAC name is oxirane;prop-2-enoyloxy prop-2-eneperoxoate.
Molecular Properties
| Compound Name | oxirane;prop-2-enoyloxy prop-2-eneperoxoate |
| PubChem CID | 88522939 |
| Molecular Formula | C8H10O6 |
| Molecular Weight | 202.16 g/mol |
| Exact Mass | 202.05 |
| IUPAC Name | oxirane;prop-2-enoyloxy prop-2-eneperoxoate |
| SMILES | C1CO1.C=CC(=O)OOOC(=O)C=C |
| InChI | InChI=1S/C6H6O5.C2H4O/c1-3-5(7)9-11-10-6(8)4-2;1-2-3-1/h3-4H,1-2H2;1-2H2 |
| InChIKey | RKHCQEXSSQPDNT-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 74.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.16 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze oxirane;prop-2-enoyloxy prop-2-eneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxirane;prop-2-enoyloxy prop-2-eneperoxoate?
The IUPAC name of oxirane;prop-2-enoyloxy prop-2-eneperoxoate (CID 88522939) is oxirane;prop-2-enoyloxy prop-2-eneperoxoate.
What is the SMILES notation for oxirane;prop-2-enoyloxy prop-2-eneperoxoate?
The canonical SMILES for oxirane;prop-2-enoyloxy prop-2-eneperoxoate is C1CO1.C=CC(=O)OOOC(=O)C=C.
What is the InChIKey of oxirane;prop-2-enoyloxy prop-2-eneperoxoate?
The InChIKey is RKHCQEXSSQPDNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O5.C2H4O/c1-3-5(7)9-11-10-6(8)4-2;1-2-3-1/h3-4H,1-2H2;1-2H2.
What are the key properties of oxirane;prop-2-enoyloxy prop-2-eneperoxoate?
oxirane;prop-2-enoyloxy prop-2-eneperoxoate has a molecular weight of 202.16 g/mol, XLogP of 0.31, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for oxirane;prop-2-enoyloxy prop-2-eneperoxoate is sourced from PubChem (CID 88522939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).