C62H80F2N2S4 — CID 153408884
5,10-bis(2-ethyloctyl)-3,8-difluoro-2,7-bis[5-(5-hexylthiophen-2-yl)thiophen-2-yl]indolo[3,2-b]indole (PubChem CID 153408884) has the molecular formula C62H80F2N2S4 and a molecular weight of 1019.60 g/mol. Its IUPAC name is 5,10-bis(2-ethyloctyl)-3,8-difluoro-2,7-bis[5-(5-hexylthiophen-2-yl)thiophen-2-yl]indolo[3,2-b]indole.
| Compound Name | 5,10-bis(2-ethyloctyl)-3,8-difluoro-2,7-bis[5-(5-hexylthiophen-2-yl)thiophen-2-yl]indolo[3,2-b]indole |
|---|---|
| PubChem CID | 153408884 |
| Molecular Formula | C62H80F2N2S4 |
| Molecular Weight | 1019.60 g/mol |
| Exact Mass | 1018.52 |
| IUPAC Name | 5,10-bis(2-ethyloctyl)-3,8-difluoro-2,7-bis[5-(5-hexylthiophen-2-yl)thiophen-2-yl]indolo[3,2-b]indole |
| SMILES | CCCCCCc1ccc(-c2ccc(-c3cc4c(cc3F)c3c(c5cc(F)c(-c6ccc(-c7ccc(CCCCCC)s7)s6)cc5n3CC(CC)CCCCCC)n4CC(CC)CCCCCC)s2)s1 |
| InChI | InChI=1S/C62H80F2N2S4/c1-7-13-17-21-25-43(11-5)41-65-53-39-47(55-33-35-59(69-55)57-31-29-45(67-57)27-23-19-15-9-3)51(63)37-49(53)62-61(65)50-38-52(64)48(40-54(50)66(62)42-44(12-6)26-22-18-14-8-2)56-34-36-60(70-56)58-32-30-46(68-58)28-24-20-16-10-4/h29-40,43-44H,7-28,41-42H2,1-6H3 |
| InChIKey | DBDBSUPNPAAWHD-UHFFFAOYSA-N |
| XLogP | 22.18 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1019.60 |
| LogP ≤ 5 | 22.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|