C56H68F2N2S4 — CID 153408892
3,8-difluoro-2,7-bis[5-(5-hexylthiophen-2-yl)thiophen-2-yl]-5,10-bis(5-methylhexyl)indolo[3,2-b]indole (PubChem CID 153408892) has the molecular formula C56H68F2N2S4 and a molecular weight of 935.44 g/mol. Its IUPAC name is 3,8-difluoro-2,7-bis[5-(5-hexylthiophen-2-yl)thiophen-2-yl]-5,10-bis(5-methylhexyl)indolo[3,2-b]indole.
| Compound Name | 3,8-difluoro-2,7-bis[5-(5-hexylthiophen-2-yl)thiophen-2-yl]-5,10-bis(5-methylhexyl)indolo[3,2-b]indole |
|---|---|
| PubChem CID | 153408892 |
| Molecular Formula | C56H68F2N2S4 |
| Molecular Weight | 935.44 g/mol |
| Exact Mass | 934.42 |
| IUPAC Name | 3,8-difluoro-2,7-bis[5-(5-hexylthiophen-2-yl)thiophen-2-yl]-5,10-bis(5-methylhexyl)indolo[3,2-b]indole |
| SMILES | CCCCCCc1ccc(-c2ccc(-c3cc4c(cc3F)c3c(c5cc(F)c(-c6ccc(-c7ccc(CCCCCC)s7)s6)cc5n3CCCCC(C)C)n4CCCCC(C)C)s2)s1 |
| InChI | InChI=1S/C56H68F2N2S4/c1-7-9-11-13-21-39-23-25-51(61-39)53-29-27-49(63-53)41-35-47-43(33-45(41)57)55-56(59(47)31-17-15-19-37(3)4)44-34-46(58)42(36-48(44)60(55)32-18-16-20-38(5)6)50-28-30-54(64-50)52-26-24-40(62-52)22-14-12-10-8-2/h23-30,33-38H,7-22,31-32H2,1-6H3 |
| InChIKey | CZXDPQAXOGOOLY-UHFFFAOYSA-N |
| XLogP | 19.84 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 935.44 |
| LogP ≤ 5 | 19.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|