About barium(2+);bis([5-hydroxy-3,4-bis(hydroxymethyl)-6-methyl-2-pyridinyl]methanesulfonate)
barium(2+);bis([5-hydroxy-3,4-bis(hydroxymethyl)-6-methyl-2-pyridinyl]methanesulfonate) (PubChem CID 153409034) has the molecular formula C18H24BaN2O12S2
and a molecular weight of 661.85 g/mol. Its IUPAC name is barium(2+);bis([5-hydroxy-3,4-bis(hydroxymethyl)-6-methyl-2-pyridinyl]methanesulfonate).
Molecular Properties
| Compound Name | barium(2+);bis([5-hydroxy-3,4-bis(hydroxymethyl)-6-methyl-2-pyridinyl]methanesulfonate) |
| PubChem CID | 153409034 |
| Molecular Formula | C18H24BaN2O12S2 |
| Molecular Weight | 661.85 g/mol |
| Exact Mass | 661.98 |
| IUPAC Name | barium(2+);bis([5-hydroxy-3,4-bis(hydroxymethyl)-6-methyl-2-pyridinyl]methanesulfonate) |
| SMILES | Cc1nc(CS(=O)(=O)[O-])c(CO)c(CO)c1O.Cc1nc(CS(=O)(=O)[O-])c(CO)c(CO)c1O.[Ba+2] |
| InChI | InChI=1S/2C9H13NO6S.Ba/c2*1-5-9(13)7(3-12)6(2-11)8(10-5)4-17(14,15)16;/h2*11-13H,2-4H2,1H3,(H,14,15,16);/q;;+2/p-2 |
| InChIKey | QYYIUGXJKHVNEH-UHFFFAOYSA-L |
| XLogP | -2.13 |
| TPSA | 261.56 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 661.85 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze barium(2+);bis([5-hydroxy-3,4-bis(hydroxymethyl)-6-methyl-2-pyridinyl]methanesulfonate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of barium(2+);bis([5-hydroxy-3,4-bis(hydroxymethyl)-6-methyl-2-pyridinyl]methanesulfonate)?
The IUPAC name of barium(2+);bis([5-hydroxy-3,4-bis(hydroxymethyl)-6-methyl-2-pyridinyl]methanesulfonate) (CID 153409034) is barium(2+);bis([5-hydroxy-3,4-bis(hydroxymethyl)-6-methyl-2-pyridinyl]methanesulfonate).
What is the SMILES notation for barium(2+);bis([5-hydroxy-3,4-bis(hydroxymethyl)-6-methyl-2-pyridinyl]methanesulfonate)?
The canonical SMILES for barium(2+);bis([5-hydroxy-3,4-bis(hydroxymethyl)-6-methyl-2-pyridinyl]methanesulfonate) is Cc1nc(CS(=O)(=O)[O-])c(CO)c(CO)c1O.Cc1nc(CS(=O)(=O)[O-])c(CO)c(CO)c1O.[Ba+2].
What is the InChIKey of barium(2+);bis([5-hydroxy-3,4-bis(hydroxymethyl)-6-methyl-2-pyridinyl]methanesulfonate)?
The InChIKey is QYYIUGXJKHVNEH-UHFFFAOYSA-L. The full InChI is InChI=1S/2C9H13NO6S.Ba/c2*1-5-9(13)7(3-12)6(2-11)8(10-5)4-17(14,15)16;/h2*11-13H,2-4H2,1H3,(H,14,15,16);/q;;+2/p-2.
What are the key properties of barium(2+);bis([5-hydroxy-3,4-bis(hydroxymethyl)-6-methyl-2-pyridinyl]methanesulfonate)?
barium(2+);bis([5-hydroxy-3,4-bis(hydroxymethyl)-6-methyl-2-pyridinyl]methanesulfonate) has a molecular weight of 661.85 g/mol, XLogP of -2.13, 8 rotatable bonds, 6 hydrogen bond donors, and 14 hydrogen bond acceptors.
Where does this data come from?
All data for barium(2+);bis([5-hydroxy-3,4-bis(hydroxymethyl)-6-methyl-2-pyridinyl]methanesulfonate) is sourced from PubChem (CID 153409034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).