C21H19ClN4O3 — CID 153409491
N-(5-chloro-2-pyridinyl)-4-hydroxy-5-methyl-2-[[4-(methylamino)benzoyl]amino]benzamide (PubChem CID 153409491) has the molecular formula C21H19ClN4O3 and a molecular weight of 410.86 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-4-hydroxy-5-methyl-2-[[4-(methylamino)benzoyl]amino]benzamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-4-hydroxy-5-methyl-2-[[4-(methylamino)benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 153409491 |
| Molecular Formula | C21H19ClN4O3 |
| Molecular Weight | 410.86 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-4-hydroxy-5-methyl-2-[[4-(methylamino)benzoyl]amino]benzamide |
| SMILES | CNc1ccc(C(=O)Nc2cc(O)c(C)cc2C(=O)Nc2ccc(Cl)cn2)cc1 |
| InChI | InChI=1S/C21H19ClN4O3/c1-12-9-16(21(29)26-19-8-5-14(22)11-24-19)17(10-18(12)27)25-20(28)13-3-6-15(23-2)7-4-13/h3-11,23,27H,1-2H3,(H,25,28)(H,24,26,29) |
| InChIKey | XMOOHTNNNXXHHY-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 103.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.86 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |