C43H27N5PtSi — CID 153411538
diphenyl-(9-phenylpyrido[2,3-b]indol-2-yl)-(12H-[1,2,4]triazolo[1,5-f]phenanthridin-12-id-11-yl)silane;platinum(2+) (PubChem CID 153411538) has the molecular formula C43H27N5PtSi and a molecular weight of 836.89 g/mol. Its IUPAC name is diphenyl-(9-phenylpyrido[2,3-b]indol-2-yl)-(12H-[1,2,4]triazolo[1,5-f]phenanthridin-12-id-11-yl)silane;platinum(2+).
| Compound Name | diphenyl-(9-phenylpyrido[2,3-b]indol-2-yl)-(12H-[1,2,4]triazolo[1,5-f]phenanthridin-12-id-11-yl)silane;platinum(2+) |
|---|---|
| PubChem CID | 153411538 |
| Molecular Formula | C43H27N5PtSi |
| Molecular Weight | 836.89 g/mol |
| Exact Mass | 836.17 |
| IUPAC Name | diphenyl-(9-phenylpyrido[2,3-b]indol-2-yl)-(12H-[1,2,4]triazolo[1,5-f]phenanthridin-12-id-11-yl)silane;platinum(2+) |
| SMILES | [Pt+2].[c-]1ccccc1-n1c2ccccc2c2ccc([Si](c3[c-]c4c(cc3)c3ccccc3n3ncnc43)(c3ccccc3)c3ccccc3)nc21 |
| InChI | InChI=1S/C43H27N5Si.Pt/c1-4-14-30(15-5-1)47-39-22-12-10-21-36(39)37-26-27-41(46-43(37)47)49(31-16-6-2-7-17-31,32-18-8-3-9-19-32)33-24-25-34-35-20-11-13-23-40(35)48-42(38(34)28-33)44-29-45-48;/h1-14,16-27,29H;/q-2;+2 |
| InChIKey | CLNZCSXYCNWULP-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 48.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.89 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|