C21H20BrN3S — CID 153418678
N-[1-(5-bromo-2-methylsulfanylpyrimidin-4-yl)propyl]-1,1-diphenylmethanimine (PubChem CID 153418678) has the molecular formula C21H20BrN3S and a molecular weight of 426.38 g/mol. Its IUPAC name is N-[1-(5-bromo-2-methylsulfanylpyrimidin-4-yl)propyl]-1,1-diphenylmethanimine.
| Compound Name | N-[1-(5-bromo-2-methylsulfanylpyrimidin-4-yl)propyl]-1,1-diphenylmethanimine |
|---|---|
| PubChem CID | 153418678 |
| Molecular Formula | C21H20BrN3S |
| Molecular Weight | 426.38 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | N-[1-(5-bromo-2-methylsulfanylpyrimidin-4-yl)propyl]-1,1-diphenylmethanimine |
| SMILES | CCC(N=C(c1ccccc1)c1ccccc1)c1nc(SC)ncc1Br |
| InChI | InChI=1S/C21H20BrN3S/c1-3-18(20-17(22)14-23-21(25-20)26-2)24-19(15-10-6-4-7-11-15)16-12-8-5-9-13-16/h4-14,18H,3H2,1-2H3 |
| InChIKey | PEHDRVHCZNYXAS-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 38.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.38 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|