C57H45F12InN6O3 — CID 153419612
tris[2-[(Z)-(4-butoxy-2,3,5,6-tetrafluorophenyl)-pyrrol-2-ylidenemethyl]pyrrol-1-yl]indigane (PubChem CID 153419612) has the molecular formula C57H45F12InN6O3 and a molecular weight of 1204.82 g/mol. Its IUPAC name is tris[2-[(Z)-(4-butoxy-2,3,5,6-tetrafluorophenyl)-pyrrol-2-ylidenemethyl]pyrrol-1-yl]indigane.
| Compound Name | tris[2-[(Z)-(4-butoxy-2,3,5,6-tetrafluorophenyl)-pyrrol-2-ylidenemethyl]pyrrol-1-yl]indigane |
|---|---|
| PubChem CID | 153419612 |
| Molecular Formula | C57H45F12InN6O3 |
| Molecular Weight | 1204.82 g/mol |
| Exact Mass | 1204.24 |
| IUPAC Name | tris[2-[(Z)-(4-butoxy-2,3,5,6-tetrafluorophenyl)-pyrrol-2-ylidenemethyl]pyrrol-1-yl]indigane |
| SMILES | CCCCOc1c(F)c(F)c(/C(=C2\C=CC=N2)c2cccn2[In](n2cccc2/C(=C2/C=CC=N2)c2c(F)c(F)c(OCCCC)c(F)c2F)n2cccc2/C(=C2/C=CC=N2)c2c(F)c(F)c(OCCCC)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/3C19H15F4N2O.In/c3*1-2-3-10-26-19-17(22)15(20)14(16(21)18(19)23)13(11-6-4-8-24-11)12-7-5-9-25-12;/h3*4-9H,2-3,10H2,1H3;/q3*-1;+3/b3*13-11+; |
| InChIKey | BLIOFJSKYYNQJD-PJYAFCPVSA-N |
| XLogP | 14.43 |
| TPSA | 79.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 79 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1204.82 |
| LogP ≤ 5 | 14.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|