C16H25BrN2OS2 — CID 153422284
(S)-N-[(1S)-1-(6-bromo-2-pyridinyl)-4-(trimethyl-λ4-sulfanyl)but-3-ynyl]-2-methylpropane-2-sulfinamide (PubChem CID 153422284) has the molecular formula C16H25BrN2OS2 and a molecular weight of 405.43 g/mol. Its IUPAC name is (S)-N-[(1S)-1-(6-bromo-2-pyridinyl)-4-(trimethyl-λ4-sulfanyl)but-3-ynyl]-2-methylpropane-2-sulfinamide.
| Compound Name | (S)-N-[(1S)-1-(6-bromo-2-pyridinyl)-4-(trimethyl-λ4-sulfanyl)but-3-ynyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 153422284 |
| Molecular Formula | C16H25BrN2OS2 |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | (S)-N-[(1S)-1-(6-bromo-2-pyridinyl)-4-(trimethyl-λ4-sulfanyl)but-3-ynyl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)[S@](=O)N[C@@H](CC#CS(C)(C)C)c1cccc(Br)n1 |
| InChI | InChI=1S/C16H25BrN2OS2/c1-16(2,3)21(20)19-14(10-8-12-22(4,5)6)13-9-7-11-15(17)18-13/h7,9,11,14,19H,10H2,1-6H3/t14-,21-/m0/s1 |
| InChIKey | WUUJRKRGRLGVAI-QKKBWIMNSA-N |
| XLogP | 3.98 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|