C27H54NO6S- — CID 153425968
3-[[2-methyl-4-[[nonyl(octyl)amino]methyl]-1,3-dioxan-2-yl]methoxy]propane-1-sulfonate (PubChem CID 153425968) has the molecular formula C27H54NO6S- and a molecular weight of 520.80 g/mol. Its IUPAC name is 3-[[2-methyl-4-[[nonyl(octyl)amino]methyl]-1,3-dioxan-2-yl]methoxy]propane-1-sulfonate.
| Compound Name | 3-[[2-methyl-4-[[nonyl(octyl)amino]methyl]-1,3-dioxan-2-yl]methoxy]propane-1-sulfonate |
|---|---|
| PubChem CID | 153425968 |
| Molecular Formula | C27H54NO6S- |
| Molecular Weight | 520.80 g/mol |
| Exact Mass | 520.37 |
| IUPAC Name | 3-[[2-methyl-4-[[nonyl(octyl)amino]methyl]-1,3-dioxan-2-yl]methoxy]propane-1-sulfonate |
| SMILES | CCCCCCCCCN(CCCCCCCC)CC1CCOC(C)(COCCCS(=O)(=O)[O-])O1 |
| InChI | InChI=1S/C27H55NO6S/c1-4-6-8-10-12-14-16-20-28(19-15-13-11-9-7-5-2)24-26-18-22-33-27(3,34-26)25-32-21-17-23-35(29,30)31/h26H,4-25H2,1-3H3,(H,29,30,31)/p-1 |
| InChIKey | FFQPQWFUVBEHTP-UHFFFAOYSA-M |
| XLogP | 5.87 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.80 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|