C25H18N3Y- — CID 153428633
3-[4-methyl-3-(1-methylpyridin-1-ium-2-yl)benzene-2-id-1-yl]-4H-benzo[c][1,5]naphthyridin-4-ide;yttrium (PubChem CID 153428633) has the molecular formula C25H18N3Y- and a molecular weight of 449.35 g/mol. Its IUPAC name is 3-[4-methyl-3-(1-methylpyridin-1-ium-2-yl)benzene-2-id-1-yl]-4H-benzo[c][1,5]naphthyridin-4-ide;yttrium.
| Compound Name | 3-[4-methyl-3-(1-methylpyridin-1-ium-2-yl)benzene-2-id-1-yl]-4H-benzo[c][1,5]naphthyridin-4-ide;yttrium |
|---|---|
| PubChem CID | 153428633 |
| Molecular Formula | C25H18N3Y- |
| Molecular Weight | 449.35 g/mol |
| Exact Mass | 449.06 |
| IUPAC Name | 3-[4-methyl-3-(1-methylpyridin-1-ium-2-yl)benzene-2-id-1-yl]-4H-benzo[c][1,5]naphthyridin-4-ide;yttrium |
| SMILES | Cc1ccc(-c2[c-]c3ncc4ccccc4c3nc2)[c-]c1-c1cccc[n+]1C.[Y] |
| InChI | InChI=1S/C25H18N3.Y/c1-17-10-11-18(13-22(17)24-9-5-6-12-28(24)2)20-14-23-25(27-16-20)21-8-4-3-7-19(21)15-26-23;/h3-12,15-16H,1-2H3;/q-1; |
| InChIKey | PDLPWDILRAOULC-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 29.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.35 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|