C18H15N2Y- — CID 170543461
4-[4-methyl-3-(1-methylpyridin-1-ium-2-yl)benzene-2-id-1-yl]-3H-pyridin-3-ide;yttrium (PubChem CID 170543461) has the molecular formula C18H15N2Y- and a molecular weight of 348.24 g/mol. Its IUPAC name is 4-[4-methyl-3-(1-methylpyridin-1-ium-2-yl)benzene-2-id-1-yl]-3H-pyridin-3-ide;yttrium.
| Compound Name | 4-[4-methyl-3-(1-methylpyridin-1-ium-2-yl)benzene-2-id-1-yl]-3H-pyridin-3-ide;yttrium |
|---|---|
| PubChem CID | 170543461 |
| Molecular Formula | C18H15N2Y- |
| Molecular Weight | 348.24 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | 4-[4-methyl-3-(1-methylpyridin-1-ium-2-yl)benzene-2-id-1-yl]-3H-pyridin-3-ide;yttrium |
| SMILES | Cc1ccc(-c2[c-]cncc2)[c-]c1-c1cccc[n+]1C.[Y] |
| InChI | InChI=1S/C18H15N2.Y/c1-14-6-7-16(15-8-10-19-11-9-15)13-17(14)18-5-3-4-12-20(18)2;/h3-8,10-12H,1-2H3;/q-1; |
| InChIKey | DVIPGQOYOKSRJX-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.24 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|