C27H21N2Y- — CID 167339211
1-methyl-2-[2-methyl-5-(1H-naphthalen-1-id-2-yl)benzene-6-id-1-yl]-3-phenylimidazol-1-ium;yttrium (PubChem CID 167339211) has the molecular formula C27H21N2Y- and a molecular weight of 462.39 g/mol. Its IUPAC name is 1-methyl-2-[2-methyl-5-(1H-naphthalen-1-id-2-yl)benzene-6-id-1-yl]-3-phenylimidazol-1-ium;yttrium.
| Compound Name | 1-methyl-2-[2-methyl-5-(1H-naphthalen-1-id-2-yl)benzene-6-id-1-yl]-3-phenylimidazol-1-ium;yttrium |
|---|---|
| PubChem CID | 167339211 |
| Molecular Formula | C27H21N2Y- |
| Molecular Weight | 462.39 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | 1-methyl-2-[2-methyl-5-(1H-naphthalen-1-id-2-yl)benzene-6-id-1-yl]-3-phenylimidazol-1-ium;yttrium |
| SMILES | Cc1ccc(-c2[c-]c3ccccc3cc2)[c-]c1-c1n(-c2ccccc2)cc[n+]1C.[Y] |
| InChI | InChI=1S/C27H21N2.Y/c1-20-12-13-24(23-15-14-21-8-6-7-9-22(21)18-23)19-26(20)27-28(2)16-17-29(27)25-10-4-3-5-11-25;/h3-17H,1-2H3;/q-1; |
| InChIKey | MHQXXJDLIGOMNI-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.39 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|