C33H24N6 — CID 153432968
5-(4,6-diphenyl-1,3,5-triazin-2-yl)-10-methyl-1-pyridin-2-ylphenazine (PubChem CID 153432968) has the molecular formula C33H24N6 and a molecular weight of 504.60 g/mol. Its IUPAC name is 5-(4,6-diphenyl-1,3,5-triazin-2-yl)-10-methyl-1-pyridin-2-ylphenazine.
| Compound Name | 5-(4,6-diphenyl-1,3,5-triazin-2-yl)-10-methyl-1-pyridin-2-ylphenazine |
|---|---|
| PubChem CID | 153432968 |
| Molecular Formula | C33H24N6 |
| Molecular Weight | 504.60 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | 5-(4,6-diphenyl-1,3,5-triazin-2-yl)-10-methyl-1-pyridin-2-ylphenazine |
| SMILES | CN1c2ccccc2N(c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c2cccc(-c3ccccn3)c21 |
| InChI | InChI=1S/C33H24N6/c1-38-27-19-8-9-20-28(27)39(29-21-12-17-25(30(29)38)26-18-10-11-22-34-26)33-36-31(23-13-4-2-5-14-23)35-32(37-33)24-15-6-3-7-16-24/h2-22H,1H3 |
| InChIKey | YWNSVHUXCXDKTH-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 58.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.60 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |