C54H34F3IrN3O-2 — CID 153433160
2-(9,9-diphenyl-2H-fluoren-2-id-1-yl)pyridine;iridium;4-pyridin-2-yl-10-[4-(trifluoromethyl)phenyl]-3H-phenoxazin-3-ide (PubChem CID 153433160) has the molecular formula C54H34F3IrN3O-2 and a molecular weight of 990.10 g/mol. Its IUPAC name is 2-(9,9-diphenyl-2H-fluoren-2-id-1-yl)pyridine;iridium;4-pyridin-2-yl-10-[4-(trifluoromethyl)phenyl]-3H-phenoxazin-3-ide.
| Compound Name | 2-(9,9-diphenyl-2H-fluoren-2-id-1-yl)pyridine;iridium;4-pyridin-2-yl-10-[4-(trifluoromethyl)phenyl]-3H-phenoxazin-3-ide |
|---|---|
| PubChem CID | 153433160 |
| Molecular Formula | C54H34F3IrN3O-2 |
| Molecular Weight | 990.10 g/mol |
| Exact Mass | 990.23 |
| IUPAC Name | 2-(9,9-diphenyl-2H-fluoren-2-id-1-yl)pyridine;iridium;4-pyridin-2-yl-10-[4-(trifluoromethyl)phenyl]-3H-phenoxazin-3-ide |
| SMILES | FC(F)(F)c1ccc(N2c3ccccc3Oc3c(-c4ccccn4)[c-]ccc32)cc1.[Ir].[c-]1ccc2c(c1-c1ccccn1)C(c1ccccc1)(c1ccccc1)c1ccccc1-2 |
| InChI | InChI=1S/C30H20N.C24H14F3N2O.Ir/c1-3-12-22(13-4-1)30(23-14-5-2-6-15-23)27-19-8-7-16-24(27)25-17-11-18-26(29(25)30)28-20-9-10-21-31-28;25-24(26,27)16-11-13-17(14-12-16)29-20-8-1-2-10-22(20)30-23-18(6-5-9-21(23)29)19-7-3-4-15-28-19;/h1-17,19-21H;1-5,7-15H;/q2*-1; |
| InChIKey | JUXALSFKNKJPPA-UHFFFAOYSA-N |
| XLogP | 14.05 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 990.10 |
| LogP ≤ 5 | 14.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|