C31H54N3Si2Zn-3 — CID 153434007
bis(trimethylsilyl)azanide;(2,6-diethylphenyl)-[4-(2,6-diethylphenyl)azanidylpentan-2-yl]azanide;zinc (PubChem CID 153434007) has the molecular formula C31H54N3Si2Zn-3 and a molecular weight of 590.36 g/mol. Its IUPAC name is bis(trimethylsilyl)azanide;(2,6-diethylphenyl)-[4-(2,6-diethylphenyl)azanidylpentan-2-yl]azanide;zinc.
| Compound Name | bis(trimethylsilyl)azanide;(2,6-diethylphenyl)-[4-(2,6-diethylphenyl)azanidylpentan-2-yl]azanide;zinc |
|---|---|
| PubChem CID | 153434007 |
| Molecular Formula | C31H54N3Si2Zn-3 |
| Molecular Weight | 590.36 g/mol |
| Exact Mass | 588.32 |
| IUPAC Name | bis(trimethylsilyl)azanide;(2,6-diethylphenyl)-[4-(2,6-diethylphenyl)azanidylpentan-2-yl]azanide;zinc |
| SMILES | CCc1cccc(CC)c1[N-]C(C)CC(C)[N-]c1c(CC)cccc1CC.C[Si](C)(C)[N-][Si](C)(C)C.[Zn] |
| InChI | InChI=1S/C25H36N2.C6H18NSi2.Zn/c1-7-20-13-11-14-21(8-2)24(20)26-18(5)17-19(6)27-25-22(9-3)15-12-16-23(25)10-4;1-8(2,3)7-9(4,5)6;/h11-16,18-19H,7-10,17H2,1-6H3;1-6H3;/q-2;-1; |
| InChIKey | ULZMOZURBSJTGP-UHFFFAOYSA-N |
| XLogP | 10.84 |
| TPSA | 42.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.36 |
| LogP ≤ 5 | 10.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|