C6H9NO3 — CID 153439504
(3R,4S)-4-azaniumyl-3-hydroxycyclopentene-1-carboxylate (PubChem CID 153439504) has the molecular formula C6H9NO3 and a molecular weight of 143.14 g/mol. Its IUPAC name is (3R,4S)-4-azaniumyl-3-hydroxycyclopentene-1-carboxylate.
| Compound Name | (3R,4S)-4-azaniumyl-3-hydroxycyclopentene-1-carboxylate |
|---|---|
| PubChem CID | 153439504 |
| Molecular Formula | C6H9NO3 |
| Molecular Weight | 143.14 g/mol |
| Exact Mass | 143.06 |
| IUPAC Name | (3R,4S)-4-azaniumyl-3-hydroxycyclopentene-1-carboxylate |
| SMILES | [NH3+][C@H]1CC(C(=O)[O-])=C[C@H]1O |
| InChI | InChI=1S/C6H9NO3/c7-4-1-3(6(9)10)2-5(4)8/h2,4-5,8H,1,7H2,(H,9,10)/t4-,5+/m0/s1 |
| InChIKey | LKYCCARKSDKHBJ-CRCLSJGQSA-N |
| XLogP | -2.96 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.14 |
| LogP ≤ 5 | -2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |