C30H31ClN4O2 — CID 153440518
N-[(9-chloro-1-methylbenzo[f]indazol-8-yl)methyl]-N-[5-[(E)-3-oxopent-1-enyl]-3-pyridinyl]cyclohexanecarboxamide (PubChem CID 153440518) has the molecular formula C30H31ClN4O2 and a molecular weight of 515.06 g/mol. Its IUPAC name is N-[(9-chloro-1-methylbenzo[f]indazol-8-yl)methyl]-N-[5-[(E)-3-oxopent-1-enyl]-3-pyridinyl]cyclohexanecarboxamide.
| Compound Name | N-[(9-chloro-1-methylbenzo[f]indazol-8-yl)methyl]-N-[5-[(E)-3-oxopent-1-enyl]-3-pyridinyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 153440518 |
| Molecular Formula | C30H31ClN4O2 |
| Molecular Weight | 515.06 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | N-[(9-chloro-1-methylbenzo[f]indazol-8-yl)methyl]-N-[5-[(E)-3-oxopent-1-enyl]-3-pyridinyl]cyclohexanecarboxamide |
| SMILES | CCC(=O)/C=C/c1cncc(N(Cc2cccc3cc4cnn(C)c4c(Cl)c23)C(=O)C2CCCCC2)c1 |
| InChI | InChI=1S/C30H31ClN4O2/c1-3-26(36)13-12-20-14-25(18-32-16-20)35(30(37)21-8-5-4-6-9-21)19-23-11-7-10-22-15-24-17-33-34(2)29(24)28(31)27(22)23/h7,10-18,21H,3-6,8-9,19H2,1-2H3/b13-12+ |
| InChIKey | LIACCRHVKOULGD-OUKQBFOZSA-N |
| XLogP | 6.88 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.06 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|