C29H31FN2O3 — CID 126643532
(E)-3-[3-[cyclohexanecarbonyl-[[7-(dimethylamino)-8-fluoronaphthalen-1-yl]methyl]amino]phenyl]prop-2-enoic acid (PubChem CID 126643532) has the molecular formula C29H31FN2O3 and a molecular weight of 474.58 g/mol. Its IUPAC name is (E)-3-[3-[cyclohexanecarbonyl-[[7-(dimethylamino)-8-fluoronaphthalen-1-yl]methyl]amino]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[cyclohexanecarbonyl-[[7-(dimethylamino)-8-fluoronaphthalen-1-yl]methyl]amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 126643532 |
| Molecular Formula | C29H31FN2O3 |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | (E)-3-[3-[cyclohexanecarbonyl-[[7-(dimethylamino)-8-fluoronaphthalen-1-yl]methyl]amino]phenyl]prop-2-enoic acid |
| SMILES | CN(C)c1ccc2cccc(CN(C(=O)C3CCCCC3)c3cccc(/C=C/C(=O)O)c3)c2c1F |
| InChI | InChI=1S/C29H31FN2O3/c1-31(2)25-16-15-21-11-7-12-23(27(21)28(25)30)19-32(29(35)22-9-4-3-5-10-22)24-13-6-8-20(18-24)14-17-26(33)34/h6-8,11-18,22H,3-5,9-10,19H2,1-2H3,(H,33,34)/b17-14+ |
| InChIKey | XNEKXOSGOFRHFL-SAPNQHFASA-N |
| XLogP | 6.26 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|