C29H28FN3O3 — CID 118367878
(E)-3-[3-[cyclohexanecarbonyl-[(9-fluoro-1-methylbenzo[f]indazol-8-yl)methyl]amino]phenyl]prop-2-enoic acid (PubChem CID 118367878) has the molecular formula C29H28FN3O3 and a molecular weight of 485.56 g/mol. Its IUPAC name is (E)-3-[3-[cyclohexanecarbonyl-[(9-fluoro-1-methylbenzo[f]indazol-8-yl)methyl]amino]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[cyclohexanecarbonyl-[(9-fluoro-1-methylbenzo[f]indazol-8-yl)methyl]amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 118367878 |
| Molecular Formula | C29H28FN3O3 |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | (E)-3-[3-[cyclohexanecarbonyl-[(9-fluoro-1-methylbenzo[f]indazol-8-yl)methyl]amino]phenyl]prop-2-enoic acid |
| SMILES | Cn1ncc2cc3cccc(CN(C(=O)C4CCCCC4)c4cccc(/C=C/C(=O)O)c4)c3c(F)c21 |
| InChI | InChI=1S/C29H28FN3O3/c1-32-28-23(17-31-32)16-21-10-6-11-22(26(21)27(28)30)18-33(29(36)20-8-3-2-4-9-20)24-12-5-7-19(15-24)13-14-25(34)35/h5-7,10-17,20H,2-4,8-9,18H2,1H3,(H,34,35)/b14-13+ |
| InChIKey | RDPVXTZIFQORTJ-BUHFOSPRSA-N |
| XLogP | 6.08 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|