C34H46IrNO2- — CID 153444823
5-butan-2-yl-3-methyl-2-(3,4,5-trimethylbenzene-6-id-1-yl)quinoline;(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium (PubChem CID 153444823) has the molecular formula C34H46IrNO2- and a molecular weight of 692.96 g/mol. Its IUPAC name is 5-butan-2-yl-3-methyl-2-(3,4,5-trimethylbenzene-6-id-1-yl)quinoline;(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium.
| Compound Name | 5-butan-2-yl-3-methyl-2-(3,4,5-trimethylbenzene-6-id-1-yl)quinoline;(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium |
|---|---|
| PubChem CID | 153444823 |
| Molecular Formula | C34H46IrNO2- |
| Molecular Weight | 692.96 g/mol |
| Exact Mass | 693.32 |
| IUPAC Name | 5-butan-2-yl-3-methyl-2-(3,4,5-trimethylbenzene-6-id-1-yl)quinoline;(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium |
| SMILES | CC(C)(C)C(=O)/C=C(\O)C(C)(C)C.CCC(C)c1cccc2nc(-c3[c-]c(C)c(C)c(C)c3)c(C)cc12.[Ir] |
| InChI | InChI=1S/C23H26N.C11H20O2.Ir/c1-7-14(2)20-9-8-10-22-21(20)13-17(5)23(24-22)19-11-15(3)18(6)16(4)12-19;1-10(2,3)8(12)7-9(13)11(4,5)6;/h8-11,13-14H,7H2,1-6H3;7,12H,1-6H3;/q-1;;/b;8-7-; |
| InChIKey | BQPXVODYPLJZCN-HXIBTQJOSA-N |
| XLogP | 9.54 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.96 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|