C39H40IrNO3- — CID 167354560
(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium;6-(4,5,7-trimethyl-1H-naphthalen-1-id-2-yl)-[1]benzofuro[2,3-c]quinoline (PubChem CID 167354560) has the molecular formula C39H40IrNO3- and a molecular weight of 762.97 g/mol. Its IUPAC name is (Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium;6-(4,5,7-trimethyl-1H-naphthalen-1-id-2-yl)-[1]benzofuro[2,3-c]quinoline.
| Compound Name | (Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium;6-(4,5,7-trimethyl-1H-naphthalen-1-id-2-yl)-[1]benzofuro[2,3-c]quinoline |
|---|---|
| PubChem CID | 167354560 |
| Molecular Formula | C39H40IrNO3- |
| Molecular Weight | 762.97 g/mol |
| Exact Mass | 763.26 |
| IUPAC Name | (Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium;6-(4,5,7-trimethyl-1H-naphthalen-1-id-2-yl)-[1]benzofuro[2,3-c]quinoline |
| SMILES | CC(C)(C)C(=O)/C=C(\O)C(C)(C)C.Cc1cc(C)c2c(C)cc(-c3nc4ccccc4c4c3oc3ccccc34)[c-]c2c1.[Ir] |
| InChI | InChI=1S/C28H20NO.C11H20O2.Ir/c1-16-12-17(2)25-18(3)14-20(15-19(25)13-16)27-28-26(21-8-4-6-10-23(21)29-27)22-9-5-7-11-24(22)30-28;1-10(2,3)8(12)7-9(13)11(4,5)6;/h4-14H,1-3H3;7,12H,1-6H3;/q-1;;/b;8-7-; |
| InChIKey | CXXHDLMTYKUPER-HXIBTQJOSA-N |
| XLogP | 10.77 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.97 |
| LogP ≤ 5 | 10.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|