C36H26N5OPt-3 — CID 153446625
CID 153446625 (PubChem CID 153446625) has the molecular formula C36H26N5OPt-3 and a molecular weight of 739.72 g/mol.
| Compound Name | CID 153446625 |
|---|---|
| PubChem CID | 153446625 |
| Molecular Formula | C36H26N5OPt-3 |
| Molecular Weight | 739.72 g/mol |
| Exact Mass | 739.18 |
| IUPAC Name | — |
| SMILES | Cn1c(-c2[c-]c(Oc3[c-]c(N4[CH-]N(c5ccccc5)C=N4)ccc3)ccc2)nc(-c2ccccc2)c1-c1ccccc1.[Pt] |
| InChI | InChI=1S/C36H26N5O.Pt/c1-39-35(28-15-7-3-8-16-28)34(27-13-5-2-6-14-27)38-36(39)29-17-11-21-32(23-29)42-33-22-12-20-31(24-33)41-26-40(25-37-41)30-18-9-4-10-19-30;/h2-22,25-26H,1H3;/q-3; |
| InChIKey | CHWSKJBRBHOTSW-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 45.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.72 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|