About CID 153446649
CID 153446649 (PubChem CID 153446649) has the molecular formula C51H43BN5Pt-3
and a molecular weight of 931.83 g/mol.
Molecular Properties
| Compound Name | CID 153446649 |
| PubChem CID | 153446649 |
| Molecular Formula | C51H43BN5Pt-3 |
| Molecular Weight | 931.83 g/mol |
| Exact Mass | 931.33 |
| IUPAC Name | — |
| SMILES | Cc1cc(C)c(B(c2[c-]c(-c3nc([C@@H]4C=CC=CC4)c(-c4ccccc4)n3C)ccc2)c2[c-]c(N3[CH-]N(c4ccccc4)C(c4ccccc4)=N3)ccc2)c(C)c1.[Pt] |
| InChI | InChI=1S/C51H43BN5.Pt/c1-36-31-37(2)47(38(3)32-36)52(44-27-18-30-46(34-44)57-35-56(45-28-15-8-16-29-45)51(54-57)41-23-13-7-14-24-41)43-26-17-25-42(33-43)50-53-48(39-19-9-5-10-20-39)49(55(50)4)40-21-11-6-12-22-40;/h5-19,21-32,35,39H,20H2,1-4H3;/q-3;/t39-;/m1./s1 |
| InChIKey | NZOWLXIGLGIHBV-DRRLCDGFSA-N |
| XLogP | 9.20 |
| TPSA | 36.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 58 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 931.83 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 153446649 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 153446649?
The IUPAC name of CID 153446649 (CID 153446649) is not available.
What is the SMILES notation for CID 153446649?
The canonical SMILES for CID 153446649 is Cc1cc(C)c(B(c2[c-]c(-c3nc([C@@H]4C=CC=CC4)c(-c4ccccc4)n3C)ccc2)c2[c-]c(N3[CH-]N(c4ccccc4)C(c4ccccc4)=N3)ccc2)c(C)c1.[Pt].
What is the InChIKey of CID 153446649?
The InChIKey is NZOWLXIGLGIHBV-DRRLCDGFSA-N. The full InChI is InChI=1S/C51H43BN5.Pt/c1-36-31-37(2)47(38(3)32-36)52(44-27-18-30-46(34-44)57-35-56(45-28-15-8-16-29-45)51(54-57)41-23-13-7-14-24-41)43-26-17-25-42(33-43)50-53-48(39-19-9-5-10-20-39)49(55(50)4)40-21-11-6-12-22-40;/h5-19,21-32,35,39H,20H2,1-4H3;/q-3;/t39-;/m1./s1.
What are the key properties of CID 153446649?
CID 153446649 has a molecular weight of 931.83 g/mol, XLogP of 9.20, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 153446649 is sourced from PubChem (CID 153446649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).