C41H42BN5 — CID 153446652
[3-[4-[(1S)-cyclohexa-2,4-dien-1-yl]-1,5-dimethylimidazol-2-yl]phenyl]-[3-(5-methyl-4-phenyl-3H-1,2,4-triazol-2-yl)phenyl]-(2,4,6-trimethylphenyl)borane (PubChem CID 153446652) has the molecular formula C41H42BN5 and a molecular weight of 615.63 g/mol. Its IUPAC name is [3-[4-[(1S)-cyclohexa-2,4-dien-1-yl]-1,5-dimethylimidazol-2-yl]phenyl]-[3-(5-methyl-4-phenyl-3H-1,2,4-triazol-2-yl)phenyl]-(2,4,6-trimethylphenyl)borane.
| Compound Name | [3-[4-[(1S)-cyclohexa-2,4-dien-1-yl]-1,5-dimethylimidazol-2-yl]phenyl]-[3-(5-methyl-4-phenyl-3H-1,2,4-triazol-2-yl)phenyl]-(2,4,6-trimethylphenyl)borane |
|---|---|
| PubChem CID | 153446652 |
| Molecular Formula | C41H42BN5 |
| Molecular Weight | 615.63 g/mol |
| Exact Mass | 615.35 |
| IUPAC Name | [3-[4-[(1S)-cyclohexa-2,4-dien-1-yl]-1,5-dimethylimidazol-2-yl]phenyl]-[3-(5-methyl-4-phenyl-3H-1,2,4-triazol-2-yl)phenyl]-(2,4,6-trimethylphenyl)borane |
| SMILES | CC1=NN(c2cccc(B(c3cccc(-c4nc([C@@H]5C=CC=CC5)c(C)n4C)c3)c3c(C)cc(C)cc3C)c2)CN1c1ccccc1 |
| InChI | InChI=1S/C41H42BN5/c1-28-23-29(2)39(30(3)24-28)42(36-19-14-22-38(26-36)47-27-46(32(5)44-47)37-20-11-8-12-21-37)35-18-13-17-34(25-35)41-43-40(31(4)45(41)6)33-15-9-7-10-16-33/h7-15,17-26,33H,16,27H2,1-6H3/t33-/m1/s1 |
| InChIKey | PRDMEWIQNKERFP-MGBGTMOVSA-N |
| XLogP | 7.05 |
| TPSA | 36.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.63 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|