C44H38BN5 — CID 153446679
[3-(3,4-diphenylpyrazol-1-yl)phenyl]-[3-(4-phenyl-3H-1,2,4-triazol-2-yl)phenyl]-(2,4,6-trimethylphenyl)borane (PubChem CID 153446679) has the molecular formula C44H38BN5 and a molecular weight of 647.64 g/mol. Its IUPAC name is [3-(3,4-diphenylpyrazol-1-yl)phenyl]-[3-(4-phenyl-3H-1,2,4-triazol-2-yl)phenyl]-(2,4,6-trimethylphenyl)borane.
| Compound Name | [3-(3,4-diphenylpyrazol-1-yl)phenyl]-[3-(4-phenyl-3H-1,2,4-triazol-2-yl)phenyl]-(2,4,6-trimethylphenyl)borane |
|---|---|
| PubChem CID | 153446679 |
| Molecular Formula | C44H38BN5 |
| Molecular Weight | 647.64 g/mol |
| Exact Mass | 647.32 |
| IUPAC Name | [3-(3,4-diphenylpyrazol-1-yl)phenyl]-[3-(4-phenyl-3H-1,2,4-triazol-2-yl)phenyl]-(2,4,6-trimethylphenyl)borane |
| SMILES | Cc1cc(C)c(B(c2cccc(N3CN(c4ccccc4)C=N3)c2)c2cccc(-n3cc(-c4ccccc4)c(-c4ccccc4)n3)c2)c(C)c1 |
| InChI | InChI=1S/C44H38BN5/c1-32-25-33(2)43(34(3)26-32)45(38-20-14-24-41(28-38)50-31-48(30-46-50)39-21-11-6-12-22-39)37-19-13-23-40(27-37)49-29-42(35-15-7-4-8-16-35)44(47-49)36-17-9-5-10-18-36/h4-30H,31H2,1-3H3 |
| InChIKey | OPXBXLPAVXQGOB-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 36.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.64 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|