C20H13ClN2O3 — CID 153449224
4-(4-chlorophenyl)-2-(2-nitrophenyl)-1,4-benzoxazine (PubChem CID 153449224) has the molecular formula C20H13ClN2O3 and a molecular weight of 364.79 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2-(2-nitrophenyl)-1,4-benzoxazine.
| Compound Name | 4-(4-chlorophenyl)-2-(2-nitrophenyl)-1,4-benzoxazine |
|---|---|
| PubChem CID | 153449224 |
| Molecular Formula | C20H13ClN2O3 |
| Molecular Weight | 364.79 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | 4-(4-chlorophenyl)-2-(2-nitrophenyl)-1,4-benzoxazine |
| SMILES | O=[N+]([O-])c1ccccc1C1=CN(c2ccc(Cl)cc2)c2ccccc2O1 |
| InChI | InChI=1S/C20H13ClN2O3/c21-14-9-11-15(12-10-14)22-13-20(26-19-8-4-3-7-18(19)22)16-5-1-2-6-17(16)23(24)25/h1-13H |
| InChIKey | LKWVDVBSKIPQEZ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.79 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|