C21H27ClN2O2 — CID 15345
N-benzyl-N-(3-morpholin-4-ium-4-ylpropyl)benzamide chloride (PubChem CID 15345) has the molecular formula C21H27ClN2O2 and a molecular weight of 374.91 g/mol. Its IUPAC name is N-benzyl-N-(3-morpholin-4-ium-4-ylpropyl)benzamide chloride.
| Compound Name | N-benzyl-N-(3-morpholin-4-ium-4-ylpropyl)benzamide chloride |
|---|---|
| PubChem CID | 15345 |
| Molecular Formula | C21H27ClN2O2 |
| Molecular Weight | 374.91 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | N-benzyl-N-(3-morpholin-4-ium-4-ylpropyl)benzamide chloride |
| SMILES | O=C(c1ccccc1)N(CCC[NH+]1CCOCC1)Cc1ccccc1.[Cl-] |
| InChI | InChI=1S/C21H26N2O2.ClH/c24-21(20-10-5-2-6-11-20)23(18-19-8-3-1-4-9-19)13-7-12-22-14-16-25-17-15-22;/h1-6,8-11H,7,12-18H2;1H |
| InChIKey | PHXAEQYBZCTMRV-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 33.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.91 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |