About (Z)-1-(9,9-dimethylacridin-10-yl)but-2-en-1-imine
(Z)-1-(9,9-dimethylacridin-10-yl)but-2-en-1-imine (PubChem CID 153452527) has the molecular formula C19H20N2
and a molecular weight of 276.38 g/mol. Its IUPAC name is (Z)-1-(9,9-dimethylacridin-10-yl)but-2-en-1-imine.
Molecular Properties
| Compound Name | (Z)-1-(9,9-dimethylacridin-10-yl)but-2-en-1-imine |
| PubChem CID | 153452527 |
| Molecular Formula | C19H20N2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | (Z)-1-(9,9-dimethylacridin-10-yl)but-2-en-1-imine |
| SMILES | [H]/N=C(\C=C/C)N1c2ccccc2C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C19H20N2/c1-4-9-18(20)21-16-12-7-5-10-14(16)19(2,3)15-11-6-8-13-17(15)21/h4-13,20H,1-3H3/b9-4-,20-18+ |
| InChIKey | PUZHDJKRMSCWMM-IQFPDGFASA-N |
| XLogP | 5.02 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1-(9,9-dimethylacridin-10-yl)but-2-en-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-(9,9-dimethylacridin-10-yl)but-2-en-1-imine?
The IUPAC name of (Z)-1-(9,9-dimethylacridin-10-yl)but-2-en-1-imine (CID 153452527) is (Z)-1-(9,9-dimethylacridin-10-yl)but-2-en-1-imine.
What is the SMILES notation for (Z)-1-(9,9-dimethylacridin-10-yl)but-2-en-1-imine?
The canonical SMILES for (Z)-1-(9,9-dimethylacridin-10-yl)but-2-en-1-imine is [H]/N=C(\C=C/C)N1c2ccccc2C(C)(C)c2ccccc21.
What is the InChIKey of (Z)-1-(9,9-dimethylacridin-10-yl)but-2-en-1-imine?
The InChIKey is PUZHDJKRMSCWMM-IQFPDGFASA-N. The full InChI is InChI=1S/C19H20N2/c1-4-9-18(20)21-16-12-7-5-10-14(16)19(2,3)15-11-6-8-13-17(15)21/h4-13,20H,1-3H3/b9-4-,20-18+.
What are the key properties of (Z)-1-(9,9-dimethylacridin-10-yl)but-2-en-1-imine?
(Z)-1-(9,9-dimethylacridin-10-yl)but-2-en-1-imine has a molecular weight of 276.38 g/mol, XLogP of 5.02, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-(9,9-dimethylacridin-10-yl)but-2-en-1-imine is sourced from PubChem (CID 153452527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).