About (N-tert-butyl-C-methylcarbonimidoyl)-[1-(diethylamino)propan-2-yl]azanide;copper(1+)
(N-tert-butyl-C-methylcarbonimidoyl)-[1-(diethylamino)propan-2-yl]azanide;copper(1+) (PubChem CID 153452818) has the molecular formula C13H28CuN3
and a molecular weight of 289.93 g/mol. Its IUPAC name is (N-tert-butyl-C-methylcarbonimidoyl)-[1-(diethylamino)propan-2-yl]azanide;copper(1+).
Molecular Properties
| Compound Name | (N-tert-butyl-C-methylcarbonimidoyl)-[1-(diethylamino)propan-2-yl]azanide;copper(1+) |
| PubChem CID | 153452818 |
| Molecular Formula | C13H28CuN3 |
| Molecular Weight | 289.93 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | (N-tert-butyl-C-methylcarbonimidoyl)-[1-(diethylamino)propan-2-yl]azanide;copper(1+) |
| SMILES | CCN(CC)CC(C)[N-]/C(C)=N/C(C)(C)C.[Cu+] |
| InChI | InChI=1S/C13H28N3.Cu/c1-8-16(9-2)10-11(3)14-12(4)15-13(5,6)7;/h11H,8-10H2,1-7H3;/q-1;+1 |
| InChIKey | KUDZQSRNDGUFLP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 29.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.93 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (N-tert-butyl-C-methylcarbonimidoyl)-[1-(diethylamino)propan-2-yl]azanide;copper(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (N-tert-butyl-C-methylcarbonimidoyl)-[1-(diethylamino)propan-2-yl]azanide;copper(1+)?
The IUPAC name of (N-tert-butyl-C-methylcarbonimidoyl)-[1-(diethylamino)propan-2-yl]azanide;copper(1+) (CID 153452818) is (N-tert-butyl-C-methylcarbonimidoyl)-[1-(diethylamino)propan-2-yl]azanide;copper(1+).
What is the SMILES notation for (N-tert-butyl-C-methylcarbonimidoyl)-[1-(diethylamino)propan-2-yl]azanide;copper(1+)?
The canonical SMILES for (N-tert-butyl-C-methylcarbonimidoyl)-[1-(diethylamino)propan-2-yl]azanide;copper(1+) is CCN(CC)CC(C)[N-]/C(C)=N/C(C)(C)C.[Cu+].
What is the InChIKey of (N-tert-butyl-C-methylcarbonimidoyl)-[1-(diethylamino)propan-2-yl]azanide;copper(1+)?
The InChIKey is KUDZQSRNDGUFLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28N3.Cu/c1-8-16(9-2)10-11(3)14-12(4)15-13(5,6)7;/h11H,8-10H2,1-7H3;/q-1;+1.
What are the key properties of (N-tert-butyl-C-methylcarbonimidoyl)-[1-(diethylamino)propan-2-yl]azanide;copper(1+)?
(N-tert-butyl-C-methylcarbonimidoyl)-[1-(diethylamino)propan-2-yl]azanide;copper(1+) has a molecular weight of 289.93 g/mol, XLogP of 3.30, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (N-tert-butyl-C-methylcarbonimidoyl)-[1-(diethylamino)propan-2-yl]azanide;copper(1+) is sourced from PubChem (CID 153452818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).