C13H28CuN3 — CID 153452818
(N-tert-butyl-C-methylcarbonimidoyl)-[1-(diethylamino)propan-2-yl]azanide;copper(1+) (PubChem CID 153452818) has the molecular formula C13H28CuN3 and a molecular weight of 289.93 g/mol. Its IUPAC name is (N-tert-butyl-C-methylcarbonimidoyl)-[1-(diethylamino)propan-2-yl]azanide;copper(1+).
| Compound Name | (N-tert-butyl-C-methylcarbonimidoyl)-[1-(diethylamino)propan-2-yl]azanide;copper(1+) |
|---|---|
| PubChem CID | 153452818 |
| Molecular Formula | C13H28CuN3 |
| Molecular Weight | 289.93 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | (N-tert-butyl-C-methylcarbonimidoyl)-[1-(diethylamino)propan-2-yl]azanide;copper(1+) |
| SMILES | CCN(CC)CC(C)[N-]/C(C)=N/C(C)(C)C.[Cu+] |
| InChI | InChI=1S/C13H28N3.Cu/c1-8-16(9-2)10-11(3)14-12(4)15-13(5,6)7;/h11H,8-10H2,1-7H3;/q-1;+1 |
| InChIKey | KUDZQSRNDGUFLP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 29.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.93 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|