C15H33N — CID 144740833
2-tert-butyl-N,N-diethyl-4,4-dimethylpentan-1-amine (PubChem CID 144740833) has the molecular formula C15H33N and a molecular weight of 227.44 g/mol. Its IUPAC name is 2-tert-butyl-N,N-diethyl-4,4-dimethylpentan-1-amine.
| Compound Name | 2-tert-butyl-N,N-diethyl-4,4-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 144740833 |
| Molecular Formula | C15H33N |
| Molecular Weight | 227.44 g/mol |
| Exact Mass | 227.26 |
| IUPAC Name | 2-tert-butyl-N,N-diethyl-4,4-dimethylpentan-1-amine |
| SMILES | CCN(CC)CC(CC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C15H33N/c1-9-16(10-2)12-13(15(6,7)8)11-14(3,4)5/h13H,9-12H2,1-8H3 |
| InChIKey | CKAMFSBEFZMTPQ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.44 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |