C13H28BrN — CID 65015773
2-(bromomethyl)-N-butan-2-yl-N-ethyl-3,3-dimethylbutan-1-amine (PubChem CID 65015773) has the molecular formula C13H28BrN and a molecular weight of 278.28 g/mol. Its IUPAC name is 2-(bromomethyl)-N-butan-2-yl-N-ethyl-3,3-dimethylbutan-1-amine.
| Compound Name | 2-(bromomethyl)-N-butan-2-yl-N-ethyl-3,3-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 65015773 |
| Molecular Formula | C13H28BrN |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | 2-(bromomethyl)-N-butan-2-yl-N-ethyl-3,3-dimethylbutan-1-amine |
| SMILES | CCC(C)N(CC)CC(CBr)C(C)(C)C |
| InChI | InChI=1S/C13H28BrN/c1-7-11(3)15(8-2)10-12(9-14)13(4,5)6/h11-12H,7-10H2,1-6H3 |
| InChIKey | ZEELWDFYVKYVQO-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|