About 2-[2-[2-(2-cyclohexylacetyl)oxyethoxy]cyclohexyl]oxyethyl 2-cyclohexylacetate
2-[2-[2-(2-cyclohexylacetyl)oxyethoxy]cyclohexyl]oxyethyl 2-cyclohexylacetate (PubChem CID 153456013) has the molecular formula C26H44O6
and a molecular weight of 452.63 g/mol. Its IUPAC name is 2-[2-[2-(2-cyclohexylacetyl)oxyethoxy]cyclohexyl]oxyethyl 2-cyclohexylacetate.
Molecular Properties
| Compound Name | 2-[2-[2-(2-cyclohexylacetyl)oxyethoxy]cyclohexyl]oxyethyl 2-cyclohexylacetate |
| PubChem CID | 153456013 |
| Molecular Formula | C26H44O6 |
| Molecular Weight | 452.63 g/mol |
| Exact Mass | 452.31 |
| IUPAC Name | 2-[2-[2-(2-cyclohexylacetyl)oxyethoxy]cyclohexyl]oxyethyl 2-cyclohexylacetate |
| SMILES | O=C(CC1CCCCC1)OCCOC1CCCCC1OCCOC(=O)CC1CCCCC1 |
| InChI | InChI=1S/C26H44O6/c27-25(19-21-9-3-1-4-10-21)31-17-15-29-23-13-7-8-14-24(23)30-16-18-32-26(28)20-22-11-5-2-6-12-22/h21-24H,1-20H2 |
| InChIKey | YSHAQPBHUAUTKG-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 452.63 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[2-(2-cyclohexylacetyl)oxyethoxy]cyclohexyl]oxyethyl 2-cyclohexylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[2-(2-cyclohexylacetyl)oxyethoxy]cyclohexyl]oxyethyl 2-cyclohexylacetate?
The IUPAC name of 2-[2-[2-(2-cyclohexylacetyl)oxyethoxy]cyclohexyl]oxyethyl 2-cyclohexylacetate (CID 153456013) is 2-[2-[2-(2-cyclohexylacetyl)oxyethoxy]cyclohexyl]oxyethyl 2-cyclohexylacetate.
What is the SMILES notation for 2-[2-[2-(2-cyclohexylacetyl)oxyethoxy]cyclohexyl]oxyethyl 2-cyclohexylacetate?
The canonical SMILES for 2-[2-[2-(2-cyclohexylacetyl)oxyethoxy]cyclohexyl]oxyethyl 2-cyclohexylacetate is O=C(CC1CCCCC1)OCCOC1CCCCC1OCCOC(=O)CC1CCCCC1.
What is the InChIKey of 2-[2-[2-(2-cyclohexylacetyl)oxyethoxy]cyclohexyl]oxyethyl 2-cyclohexylacetate?
The InChIKey is YSHAQPBHUAUTKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H44O6/c27-25(19-21-9-3-1-4-10-21)31-17-15-29-23-13-7-8-14-24(23)30-16-18-32-26(28)20-22-11-5-2-6-12-22/h21-24H,1-20H2.
What are the key properties of 2-[2-[2-(2-cyclohexylacetyl)oxyethoxy]cyclohexyl]oxyethyl 2-cyclohexylacetate?
2-[2-[2-(2-cyclohexylacetyl)oxyethoxy]cyclohexyl]oxyethyl 2-cyclohexylacetate has a molecular weight of 452.63 g/mol, XLogP of 5.36, 12 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[2-(2-cyclohexylacetyl)oxyethoxy]cyclohexyl]oxyethyl 2-cyclohexylacetate is sourced from PubChem (CID 153456013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).