C18H14FN3O — CID 153457023
4-ethynyl-5-fluoro-N-[(4-methoxyphenyl)methyl]quinazolin-2-amine (PubChem CID 153457023) has the molecular formula C18H14FN3O and a molecular weight of 307.33 g/mol. Its IUPAC name is 4-ethynyl-5-fluoro-N-[(4-methoxyphenyl)methyl]quinazolin-2-amine.
| Compound Name | 4-ethynyl-5-fluoro-N-[(4-methoxyphenyl)methyl]quinazolin-2-amine |
|---|---|
| PubChem CID | 153457023 |
| Molecular Formula | C18H14FN3O |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 4-ethynyl-5-fluoro-N-[(4-methoxyphenyl)methyl]quinazolin-2-amine |
| SMILES | C#Cc1nc(NCc2ccc(OC)cc2)nc2cccc(F)c12 |
| InChI | InChI=1S/C18H14FN3O/c1-3-15-17-14(19)5-4-6-16(17)22-18(21-15)20-11-12-7-9-13(23-2)10-8-12/h1,4-10H,11H2,2H3,(H,20,21,22) |
| InChIKey | BIEFNRUGHSFVDW-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|