C17H17FN4O — CID 68517878
2-(aminomethyl)-5-fluoro-N-[(4-methoxyphenyl)methyl]quinazolin-4-amine (PubChem CID 68517878) has the molecular formula C17H17FN4O and a molecular weight of 312.35 g/mol. Its IUPAC name is 2-(aminomethyl)-5-fluoro-N-[(4-methoxyphenyl)methyl]quinazolin-4-amine.
| Compound Name | 2-(aminomethyl)-5-fluoro-N-[(4-methoxyphenyl)methyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 68517878 |
| Molecular Formula | C17H17FN4O |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 2-(aminomethyl)-5-fluoro-N-[(4-methoxyphenyl)methyl]quinazolin-4-amine |
| SMILES | COc1ccc(CNc2nc(CN)nc3cccc(F)c23)cc1 |
| InChI | InChI=1S/C17H17FN4O/c1-23-12-7-5-11(6-8-12)10-20-17-16-13(18)3-2-4-14(16)21-15(9-19)22-17/h2-8H,9-10,19H2,1H3,(H,20,21,22) |
| InChIKey | LHIKZRNLVCBCCU-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |