C56H32N6Pt — CID 153465649
CID 153465649 (PubChem CID 153465649) has the molecular formula C56H32N6Pt and a molecular weight of 983.99 g/mol.
| Compound Name | CID 153465649 |
|---|---|
| PubChem CID | 153465649 |
| Molecular Formula | C56H32N6Pt |
| Molecular Weight | 983.99 g/mol |
| Exact Mass | 983.23 |
| IUPAC Name | — |
| SMILES | [Pt+2].[c-]1c(-n2c3[c-]c(-c4cnc5cc6ccccc6cc5n4)cnc3c3cc4ccccc4cc32)ccc2c3ccc(-c4ccccc4)cc3n(-c3cc(-c4ccccc4)ccn3)c12 |
| InChI | InChI=1S/C56H32N6.Pt/c1-3-11-35(12-4-1)41-19-21-45-46-22-20-44(32-53(46)62(51(45)29-41)55-31-42(23-24-57-55)36-13-5-2-6-14-36)61-52-28-40-18-10-7-15-37(40)25-47(52)56-54(61)30-43(33-59-56)50-34-58-48-26-38-16-8-9-17-39(38)27-49(48)60-50;/h1-29,31,33-34H;/q-2;+2 |
| InChIKey | WHEHOTOESXSQMV-UHFFFAOYSA-N |
| XLogP | 13.52 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 983.99 |
| LogP ≤ 5 | 13.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|