C50H28N6Pt — CID 153465681
CID 153465681 (PubChem CID 153465681) has the molecular formula C50H28N6Pt and a molecular weight of 907.89 g/mol.
| Compound Name | CID 153465681 |
|---|---|
| PubChem CID | 153465681 |
| Molecular Formula | C50H28N6Pt |
| Molecular Weight | 907.89 g/mol |
| Exact Mass | 907.20 |
| IUPAC Name | — |
| SMILES | [Pt+2].[c-]1c(-n2c3[c-]c(-c4cnc5cc6ccccc6cc5n4)cnc3c3cc4ccccc4cc32)ccc2c3cc(-c4ccccc4)ccc3n(-c3ccccn3)c12 |
| InChI | InChI=1S/C50H28N6.Pt/c1-2-10-31(11-3-1)36-17-20-45-40(22-36)39-19-18-38(28-47(39)56(45)49-16-8-9-21-51-49)55-46-26-35-15-7-4-12-32(35)23-41(46)50-48(55)27-37(29-53-50)44-30-52-42-24-33-13-5-6-14-34(33)25-43(42)54-44;/h1-26,29-30H;/q-2;+2 |
| InChIKey | TWSLJGPBYYQGLE-UHFFFAOYSA-N |
| XLogP | 11.85 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 907.89 |
| LogP ≤ 5 | 11.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|