C13H31N3O — CID 153468159
N'-tert-butyl-N-[2-[2-(tert-butylamino)ethoxy]ethyl]methanediamine (PubChem CID 153468159) has the molecular formula C13H31N3O and a molecular weight of 245.41 g/mol. Its IUPAC name is N'-tert-butyl-N-[2-[2-(tert-butylamino)ethoxy]ethyl]methanediamine.
| Compound Name | N'-tert-butyl-N-[2-[2-(tert-butylamino)ethoxy]ethyl]methanediamine |
|---|---|
| PubChem CID | 153468159 |
| Molecular Formula | C13H31N3O |
| Molecular Weight | 245.41 g/mol |
| Exact Mass | 245.25 |
| IUPAC Name | N'-tert-butyl-N-[2-[2-(tert-butylamino)ethoxy]ethyl]methanediamine |
| SMILES | CC(C)(C)NCCOCCNCNC(C)(C)C |
| InChI | InChI=1S/C13H31N3O/c1-12(2,3)15-8-10-17-9-7-14-11-16-13(4,5)6/h14-16H,7-11H2,1-6H3 |
| InChIKey | XPAOGZXFXXFMKD-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 45.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.41 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|