C69H53N — CID 153471039
N-[4-[4-(1,2-diphenylethyl)cyclohexa-2,4-dien-1-yl]phenyl]-9,9-diphenyl-N-[2,3,5,6-tetradeuterio-4-(4-phenylphenyl)phenyl]fluoren-2-amine (PubChem CID 153471039) has the molecular formula C69H53N and a molecular weight of 900.21 g/mol. Its IUPAC name is N-[4-[4-(1,2-diphenylethyl)cyclohexa-2,4-dien-1-yl]phenyl]-9,9-diphenyl-N-[2,3,5,6-tetradeuterio-4-(4-phenylphenyl)phenyl]fluoren-2-amine.
| Compound Name | N-[4-[4-(1,2-diphenylethyl)cyclohexa-2,4-dien-1-yl]phenyl]-9,9-diphenyl-N-[2,3,5,6-tetradeuterio-4-(4-phenylphenyl)phenyl]fluoren-2-amine |
|---|---|
| PubChem CID | 153471039 |
| Molecular Formula | C69H53N |
| Molecular Weight | 900.21 g/mol |
| Exact Mass | 899.44 |
| IUPAC Name | N-[4-[4-(1,2-diphenylethyl)cyclohexa-2,4-dien-1-yl]phenyl]-9,9-diphenyl-N-[2,3,5,6-tetradeuterio-4-(4-phenylphenyl)phenyl]fluoren-2-amine |
| SMILES | [2H]c1c([2H])c(N(c2ccc(C3C=CC(C(Cc4ccccc4)c4ccccc4)=CC3)cc2)c2ccc3c(c2)C(c2ccccc2)(c2ccccc2)c2ccccc2-3)c([2H])c([2H])c1-c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C69H53N/c1-6-18-50(19-7-1)48-66(57-22-10-3-11-23-57)58-36-34-54(35-37-58)56-40-44-62(45-41-56)70(61-42-38-55(39-43-61)53-32-30-52(31-33-53)51-20-8-2-9-21-51)63-46-47-65-64-28-16-17-29-67(64)69(68(65)49-63,59-24-12-4-13-25-59)60-26-14-5-15-27-60/h1-34,36-47,49,54,66H,35,48H2/i38D,39D,42D,43D |
| InChIKey | YMVGWIDHBITESQ-CHJCJQDESA-N |
| XLogP | 17.85 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 900.21 |
| LogP ≤ 5 | 17.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |