C55H41N — CID 153471310
N-[3,4-bis(ethenyl)hexa-1,3,5-trien-2-yl]-1,3,4-trideuterio-N-(3-phenanthren-9-ylphenyl)-9,9-diphenylfluoren-2-amine (PubChem CID 153471310) has the molecular formula C55H41N and a molecular weight of 718.96 g/mol. Its IUPAC name is N-[3,4-bis(ethenyl)hexa-1,3,5-trien-2-yl]-1,3,4-trideuterio-N-(3-phenanthren-9-ylphenyl)-9,9-diphenylfluoren-2-amine.
| Compound Name | N-[3,4-bis(ethenyl)hexa-1,3,5-trien-2-yl]-1,3,4-trideuterio-N-(3-phenanthren-9-ylphenyl)-9,9-diphenylfluoren-2-amine |
|---|---|
| PubChem CID | 153471310 |
| Molecular Formula | C55H41N |
| Molecular Weight | 718.96 g/mol |
| Exact Mass | 718.34 |
| IUPAC Name | N-[3,4-bis(ethenyl)hexa-1,3,5-trien-2-yl]-1,3,4-trideuterio-N-(3-phenanthren-9-ylphenyl)-9,9-diphenylfluoren-2-amine |
| SMILES | [2H]c1c([2H])c(N(C(=C)C(C=C)=C(C=C)C=C)c2cccc(-c3cc4ccccc4c4ccccc34)c2)c([2H])c2c1-c1ccccc1C2(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C55H41N/c1-5-39(6-2)46(7-3)38(4)56(44-27-20-22-40(35-44)52-36-41-21-14-15-28-47(41)48-29-16-17-30-49(48)52)45-33-34-51-50-31-18-19-32-53(50)55(54(51)37-45,42-23-10-8-11-24-42)43-25-12-9-13-26-43/h5-37H,1-4H2/i33D,34D,37D |
| InChIKey | KLDMADPLXZTBLI-MNVSFMHQSA-N |
| XLogP | 14.53 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.96 |
| LogP ≤ 5 | 14.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|