C45H31N — CID 153471352
1,3,4-trideuterio-N-(4-phenanthren-9-ylphenyl)-9,9-diphenylfluoren-2-amine (PubChem CID 153471352) has the molecular formula C45H31N and a molecular weight of 588.77 g/mol. Its IUPAC name is 1,3,4-trideuterio-N-(4-phenanthren-9-ylphenyl)-9,9-diphenylfluoren-2-amine.
| Compound Name | 1,3,4-trideuterio-N-(4-phenanthren-9-ylphenyl)-9,9-diphenylfluoren-2-amine |
|---|---|
| PubChem CID | 153471352 |
| Molecular Formula | C45H31N |
| Molecular Weight | 588.77 g/mol |
| Exact Mass | 588.26 |
| IUPAC Name | 1,3,4-trideuterio-N-(4-phenanthren-9-ylphenyl)-9,9-diphenylfluoren-2-amine |
| SMILES | [2H]c1c([2H])c2c(c([2H])c1Nc1ccc(-c3cc4ccccc4c4ccccc34)cc1)C(c1ccccc1)(c1ccccc1)c1ccccc1-2 |
| InChI | InChI=1S/C45H31N/c1-3-14-33(15-4-1)45(34-16-5-2-6-17-34)43-22-12-11-21-40(43)41-28-27-36(30-44(41)45)46-35-25-23-31(24-26-35)42-29-32-13-7-8-18-37(32)38-19-9-10-20-39(38)42/h1-30,46H/i27D,28D,30D |
| InChIKey | BYITXUXOTDFPHL-OBEMDJKPSA-N |
| XLogP | 11.77 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.77 |
| LogP ≤ 5 | 11.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|