C13HF4I4O5S- — CID 153471588
2,3,5,6-tetrafluoro-4-(2,3,5,6-tetraiodobenzoyl)oxybenzenesulfonate (PubChem CID 153471588) has the molecular formula C13HF4I4O5S- and a molecular weight of 852.82 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-(2,3,5,6-tetraiodobenzoyl)oxybenzenesulfonate.
| Compound Name | 2,3,5,6-tetrafluoro-4-(2,3,5,6-tetraiodobenzoyl)oxybenzenesulfonate |
|---|---|
| PubChem CID | 153471588 |
| Molecular Formula | C13HF4I4O5S- |
| Molecular Weight | 852.82 g/mol |
| Exact Mass | 852.57 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-(2,3,5,6-tetraiodobenzoyl)oxybenzenesulfonate |
| SMILES | O=C(Oc1c(F)c(F)c(S(=O)(=O)[O-])c(F)c1F)c1c(I)c(I)cc(I)c1I |
| InChI | InChI=1S/C13H2F4I4O5S/c14-5-7(16)12(27(23,24)25)8(17)6(15)11(5)26-13(22)4-9(20)2(18)1-3(19)10(4)21/h1H,(H,23,24,25)/p-1 |
| InChIKey | UGLCBLCMNRTTRD-UHFFFAOYSA-M |
| XLogP | 4.78 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.82 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|