C31H22IrN6+ — CID 153483346
CID 153483346 (PubChem CID 153483346) has the molecular formula C31H22IrN6+ and a molecular weight of 670.78 g/mol.
| Compound Name | CID 153483346 |
|---|---|
| PubChem CID | 153483346 |
| Molecular Formula | C31H22IrN6+ |
| Molecular Weight | 670.78 g/mol |
| Exact Mass | 671.15 |
| IUPAC Name | — |
| SMILES | CN1[CH-]N(c2[c-]cccc2)c2ccccc21.[C-]1=c2ccccc2=[N+]2c3nccnc3-c3cccnc3C12.[Ir+3] |
| InChI | InChI=1S/C17H10N4.C14H12N2.Ir/c1-2-6-13-11(4-1)10-14-15-12(5-3-7-18-15)16-17(21(13)14)20-9-8-19-16;1-15-11-16(12-7-3-2-4-8-12)14-10-6-5-9-13(14)15;/h1-9,14H;2-7,9-11H,1H3;/q;-2;+3 |
| InChIKey | ALOMOVKRKPQNIQ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 48.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.78 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|