About CID 153483346
CID 153483346 (PubChem CID 153483346) has the molecular formula C31H22IrN6+
and a molecular weight of 670.78 g/mol.
Molecular Properties
| Compound Name | CID 153483346 |
| PubChem CID | 153483346 |
| Molecular Formula | C31H22IrN6+ |
| Molecular Weight | 670.78 g/mol |
| Exact Mass | 671.15 |
| IUPAC Name | — |
| SMILES | CN1[CH-]N(c2[c-]cccc2)c2ccccc21.[C-]1=c2ccccc2=[N+]2c3nccnc3-c3cccnc3C12.[Ir+3] |
| InChI | InChI=1S/C17H10N4.C14H12N2.Ir/c1-2-6-13-11(4-1)10-14-15-12(5-3-7-18-15)16-17(21(13)14)20-9-8-19-16;1-15-11-16(12-7-3-2-4-8-12)14-10-6-5-9-13(14)15;/h1-9,14H;2-7,9-11H,1H3;/q;-2;+3 |
| InChIKey | ALOMOVKRKPQNIQ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 48.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 670.78 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze CID 153483346 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 153483346?
The IUPAC name of CID 153483346 (CID 153483346) is not available.
What is the SMILES notation for CID 153483346?
The canonical SMILES for CID 153483346 is CN1[CH-]N(c2[c-]cccc2)c2ccccc21.[C-]1=c2ccccc2=[N+]2c3nccnc3-c3cccnc3C12.[Ir+3].
What is the InChIKey of CID 153483346?
The InChIKey is ALOMOVKRKPQNIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10N4.C14H12N2.Ir/c1-2-6-13-11(4-1)10-14-15-12(5-3-7-18-15)16-17(21(13)14)20-9-8-19-16;1-15-11-16(12-7-3-2-4-8-12)14-10-6-5-9-13(14)15;/h1-9,14H;2-7,9-11H,1H3;/q;-2;+3.
What are the key properties of CID 153483346?
CID 153483346 has a molecular weight of 670.78 g/mol, XLogP of 4.28, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 153483346 is sourced from PubChem (CID 153483346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).