C36H26IrN5 — CID 153483319
CID 153483319 (PubChem CID 153483319) has the molecular formula C36H26IrN5 and a molecular weight of 720.86 g/mol.
| Compound Name | CID 153483319 |
|---|---|
| PubChem CID | 153483319 |
| Molecular Formula | C36H26IrN5 |
| Molecular Weight | 720.86 g/mol |
| Exact Mass | 721.18 |
| IUPAC Name | — |
| SMILES | CN1[CH-]N(c2[c-]cccc2)c2ccccc21.[Ir+3].[c-]1cnc2n1C1N=CC=CC1c1c-2c2ccccc2c2ccccc12 |
| InChI | InChI=1S/C22H14N3.C14H12N2.Ir/c1-3-8-16-14(6-1)15-7-2-4-9-17(15)20-19(16)18-10-5-11-23-21(18)25-13-12-24-22(20)25;1-15-11-16(12-7-3-2-4-8-12)14-10-6-5-9-13(14)15;/h1-12,18,21H;2-7,9-11H,1H3;/q-1;-2;+3 |
| InChIKey | STOZENNZEZZORJ-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 36.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.86 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|