C29H28N4O2 — CID 153485619
(6aR,7R,10aS)-4-(cyclobutylmethoxy)-9-isocyano-7,10a-dimethyl-2-quinolin-4-yl-5,6,6a,7-tetrahydrobenzo[h]quinazolin-8-one (PubChem CID 153485619) has the molecular formula C29H28N4O2 and a molecular weight of 464.57 g/mol. Its IUPAC name is (6aR,7R,10aS)-4-(cyclobutylmethoxy)-9-isocyano-7,10a-dimethyl-2-quinolin-4-yl-5,6,6a,7-tetrahydrobenzo[h]quinazolin-8-one.
| Compound Name | (6aR,7R,10aS)-4-(cyclobutylmethoxy)-9-isocyano-7,10a-dimethyl-2-quinolin-4-yl-5,6,6a,7-tetrahydrobenzo[h]quinazolin-8-one |
|---|---|
| PubChem CID | 153485619 |
| Molecular Formula | C29H28N4O2 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | (6aR,7R,10aS)-4-(cyclobutylmethoxy)-9-isocyano-7,10a-dimethyl-2-quinolin-4-yl-5,6,6a,7-tetrahydrobenzo[h]quinazolin-8-one |
| SMILES | [C-]#[N+]C1=C[C@@]2(C)c3nc(-c4ccnc5ccccc45)nc(OCC4CCC4)c3CC[C@@H]2[C@@H](C)C1=O |
| InChI | InChI=1S/C29H28N4O2/c1-17-22-12-11-21-26(29(22,2)15-24(30-3)25(17)34)32-27(33-28(21)35-16-18-7-6-8-18)20-13-14-31-23-10-5-4-9-19(20)23/h4-5,9-10,13-15,17-18,22H,6-8,11-12,16H2,1-2H3/t17-,22-,29-/m1/s1 |
| InChIKey | XPIVFDBFPAKTPD-UEGGZXHXSA-N |
| XLogP | 5.71 |
| TPSA | 69.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|