C32H32N2O2 — CID 153489099
(4Z)-2-(10a-methyl-7,8,9,10-tetrahydro-5H-cyclohepta[b]indol-6-yl)-4-(10a-methyl-7,8,9,10-tetrahydrocyclohepta[b]indol-6-ylidene)-3-hydroxycyclobut-2-en-1-one (PubChem CID 153489099) has the molecular formula C32H32N2O2 and a molecular weight of 476.62 g/mol. Its IUPAC name is (4Z)-2-(10a-methyl-7,8,9,10-tetrahydro-5H-cyclohepta[b]indol-6-yl)-4-(10a-methyl-7,8,9,10-tetrahydrocyclohepta[b]indol-6-ylidene)-3-hydroxycyclobut-2-en-1-one.
| Compound Name | (4Z)-2-(10a-methyl-7,8,9,10-tetrahydro-5H-cyclohepta[b]indol-6-yl)-4-(10a-methyl-7,8,9,10-tetrahydrocyclohepta[b]indol-6-ylidene)-3-hydroxycyclobut-2-en-1-one |
|---|---|
| PubChem CID | 153489099 |
| Molecular Formula | C32H32N2O2 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.25 |
| IUPAC Name | (4Z)-2-(10a-methyl-7,8,9,10-tetrahydro-5H-cyclohepta[b]indol-6-yl)-4-(10a-methyl-7,8,9,10-tetrahydrocyclohepta[b]indol-6-ylidene)-3-hydroxycyclobut-2-en-1-one |
| SMILES | CC12CCCC/C(=C3/C(=O)C(C4=C5Nc6ccccc6C5(C)CCCC4)=C3O)C1=Nc1ccccc12 |
| InChI | InChI=1S/C32H32N2O2/c1-31-17-9-7-11-19(29(31)33-23-15-5-3-13-21(23)31)25-27(35)26(28(25)36)20-12-8-10-18-32(2)22-14-4-6-16-24(22)34-30(20)32/h3-6,13-16,33,35H,7-12,17-18H2,1-2H3/b26-20- |
| InChIKey | MHCKQXRWZYNEDN-QOMWVZHYSA-N |
| XLogP | 7.51 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|