C6H6O6 — CID 153489332
(4-hydroxy-2,6-dioxooxan-4-yl) formate (PubChem CID 153489332) has the molecular formula C6H6O6 and a molecular weight of 174.11 g/mol. Its IUPAC name is (4-hydroxy-2,6-dioxooxan-4-yl) formate.
| Compound Name | (4-hydroxy-2,6-dioxooxan-4-yl) formate |
|---|---|
| PubChem CID | 153489332 |
| Molecular Formula | C6H6O6 |
| Molecular Weight | 174.11 g/mol |
| Exact Mass | 174.02 |
| IUPAC Name | (4-hydroxy-2,6-dioxooxan-4-yl) formate |
| SMILES | O=COC1(O)CC(=O)OC(=O)C1 |
| InChI | InChI=1S/C6H6O6/c7-3-11-6(10)1-4(8)12-5(9)2-6/h3,10H,1-2H2 |
| InChIKey | FUIYYMGTVNZJTH-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.11 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|