C9H11ClO4 — CID 12664635
(1-chloro-4,4-dimethyl-2,6-dioxocyclohexyl) formate (PubChem CID 12664635) has the molecular formula C9H11ClO4 and a molecular weight of 218.64 g/mol. Its IUPAC name is (1-chloro-4,4-dimethyl-2,6-dioxocyclohexyl) formate.
| Compound Name | (1-chloro-4,4-dimethyl-2,6-dioxocyclohexyl) formate |
|---|---|
| PubChem CID | 12664635 |
| Molecular Formula | C9H11ClO4 |
| Molecular Weight | 218.64 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | (1-chloro-4,4-dimethyl-2,6-dioxocyclohexyl) formate |
| SMILES | CC1(C)CC(=O)C(Cl)(OC=O)C(=O)C1 |
| InChI | InChI=1S/C9H11ClO4/c1-8(2)3-6(12)9(10,14-5-11)7(13)4-8/h5H,3-4H2,1-2H3 |
| InChIKey | NSDMYWAVYKSOQS-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.64 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|